C10H18OSi — CID 11116689
cis-(1R,2S)-2-(2-trimethylsilylethynyl)cyclopentan-1-ol (PubChem CID 11116689) has the molecular formula C10H18OSi and a molecular weight of 182.34 g/mol. Its IUPAC name is cis-(1R,2S)-2-(2-trimethylsilylethynyl)cyclopentan-1-ol.
| Compound Name | cis-(1R,2S)-2-(2-trimethylsilylethynyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 11116689 |
| Molecular Formula | C10H18OSi |
| Molecular Weight | 182.34 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | cis-(1R,2S)-2-(2-trimethylsilylethynyl)cyclopentan-1-ol |
| SMILES | C[Si](C)(C)C#C[C@@H]1CCC[C@H]1O |
| InChI | InChI=1S/C10H18OSi/c1-12(2,3)8-7-9-5-4-6-10(9)11/h9-11H,4-6H2,1-3H3/t9-,10+/m0/s1 |
| InChIKey | JDIGGKMUXMYUNY-VHSXEESVSA-N |
| XLogP | 2.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.34 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|