About 3-(2-oxo-1,3-oxazolidin-3-yl)propyl acetate
3-(2-oxo-1,3-oxazolidin-3-yl)propyl acetate (PubChem CID 11116771) has the molecular formula C8H13NO4
and a molecular weight of 187.19 g/mol. Its IUPAC name is 3-(2-oxo-1,3-oxazolidin-3-yl)propyl acetate.
Molecular Properties
| Compound Name | 3-(2-oxo-1,3-oxazolidin-3-yl)propyl acetate |
| PubChem CID | 11116771 |
| Molecular Formula | C8H13NO4 |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | 3-(2-oxo-1,3-oxazolidin-3-yl)propyl acetate |
| SMILES | CC(=O)OCCCN1CCOC1=O |
| InChI | InChI=1S/C8H13NO4/c1-7(10)12-5-2-3-9-4-6-13-8(9)11/h2-6H2,1H3 |
| InChIKey | HWJSMGMTPGFFHF-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-oxo-1,3-oxazolidin-3-yl)propyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-oxo-1,3-oxazolidin-3-yl)propyl acetate?
The IUPAC name of 3-(2-oxo-1,3-oxazolidin-3-yl)propyl acetate (CID 11116771) is 3-(2-oxo-1,3-oxazolidin-3-yl)propyl acetate.
What is the SMILES notation for 3-(2-oxo-1,3-oxazolidin-3-yl)propyl acetate?
The canonical SMILES for 3-(2-oxo-1,3-oxazolidin-3-yl)propyl acetate is CC(=O)OCCCN1CCOC1=O.
What is the InChIKey of 3-(2-oxo-1,3-oxazolidin-3-yl)propyl acetate?
The InChIKey is HWJSMGMTPGFFHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO4/c1-7(10)12-5-2-3-9-4-6-13-8(9)11/h2-6H2,1H3.
What are the key properties of 3-(2-oxo-1,3-oxazolidin-3-yl)propyl acetate?
3-(2-oxo-1,3-oxazolidin-3-yl)propyl acetate has a molecular weight of 187.19 g/mol, XLogP of 0.39, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-oxo-1,3-oxazolidin-3-yl)propyl acetate is sourced from PubChem (CID 11116771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).