About (4S,5S)-4-(1,3-dioxolan-2-yl)-5-(hydroxymethyl)oxolan-2-one
(4S,5S)-4-(1,3-dioxolan-2-yl)-5-(hydroxymethyl)oxolan-2-one (PubChem CID 11116788) has the molecular formula C8H12O5
and a molecular weight of 188.18 g/mol. Its IUPAC name is (4S,5S)-4-(1,3-dioxolan-2-yl)-5-(hydroxymethyl)oxolan-2-one.
Molecular Properties
| Compound Name | (4S,5S)-4-(1,3-dioxolan-2-yl)-5-(hydroxymethyl)oxolan-2-one |
| PubChem CID | 11116788 |
| Molecular Formula | C8H12O5 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | (4S,5S)-4-(1,3-dioxolan-2-yl)-5-(hydroxymethyl)oxolan-2-one |
| SMILES | O=C1C[C@H](C2OCCO2)[C@@H](CO)O1 |
| InChI | InChI=1S/C8H12O5/c9-4-6-5(3-7(10)13-6)8-11-1-2-12-8/h5-6,8-9H,1-4H2/t5-,6+/m0/s1 |
| InChIKey | QZOMWDHWWYKWMO-NTSWFWBYSA-N |
| XLogP | -0.72 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4S,5S)-4-(1,3-dioxolan-2-yl)-5-(hydroxymethyl)oxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S,5S)-4-(1,3-dioxolan-2-yl)-5-(hydroxymethyl)oxolan-2-one?
The IUPAC name of (4S,5S)-4-(1,3-dioxolan-2-yl)-5-(hydroxymethyl)oxolan-2-one (CID 11116788) is (4S,5S)-4-(1,3-dioxolan-2-yl)-5-(hydroxymethyl)oxolan-2-one.
What is the SMILES notation for (4S,5S)-4-(1,3-dioxolan-2-yl)-5-(hydroxymethyl)oxolan-2-one?
The canonical SMILES for (4S,5S)-4-(1,3-dioxolan-2-yl)-5-(hydroxymethyl)oxolan-2-one is O=C1C[C@H](C2OCCO2)[C@@H](CO)O1.
What is the InChIKey of (4S,5S)-4-(1,3-dioxolan-2-yl)-5-(hydroxymethyl)oxolan-2-one?
The InChIKey is QZOMWDHWWYKWMO-NTSWFWBYSA-N. The full InChI is InChI=1S/C8H12O5/c9-4-6-5(3-7(10)13-6)8-11-1-2-12-8/h5-6,8-9H,1-4H2/t5-,6+/m0/s1.
What are the key properties of (4S,5S)-4-(1,3-dioxolan-2-yl)-5-(hydroxymethyl)oxolan-2-one?
(4S,5S)-4-(1,3-dioxolan-2-yl)-5-(hydroxymethyl)oxolan-2-one has a molecular weight of 188.18 g/mol, XLogP of -0.72, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4S,5S)-4-(1,3-dioxolan-2-yl)-5-(hydroxymethyl)oxolan-2-one is sourced from PubChem (CID 11116788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).