C10H5N3OS — CID 1111681
3-sulfanylidene-2H-indeno[2,1-e][1,2,4]triazin-5-one (PubChem CID 1111681) has the molecular formula C10H5N3OS and a molecular weight of 215.24 g/mol. Its IUPAC name is 3-sulfanylidene-2H-indeno[2,1-e][1,2,4]triazin-5-one.
| Compound Name | 3-sulfanylidene-2H-indeno[2,1-e][1,2,4]triazin-5-one |
|---|---|
| PubChem CID | 1111681 |
| Molecular Formula | C10H5N3OS |
| Molecular Weight | 215.24 g/mol |
| Exact Mass | 215.02 |
| IUPAC Name | 3-sulfanylidene-2H-indeno[2,1-e][1,2,4]triazin-5-one |
| SMILES | O=C1c2ccccc2-c2n[nH]c(=S)nc21 |
| InChI | InChI=1S/C10H5N3OS/c14-9-6-4-2-1-3-5(6)7-8(9)11-10(15)13-12-7/h1-4H,(H,11,13,15) |
| InChIKey | UUHBXDGGIBCXQJ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.24 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|