C21H34N4O4 — CID 111168617
ethyl 7-[[ethylamino-[4-(furan-2-carbonyl)piperazin-1-yl]methylidene]amino]heptanoate (PubChem CID 111168617) has the molecular formula C21H34N4O4 and a molecular weight of 406.53 g/mol. Its IUPAC name is ethyl 7-[[ethylamino-[4-(furan-2-carbonyl)piperazin-1-yl]methylidene]amino]heptanoate.
| Compound Name | ethyl 7-[[ethylamino-[4-(furan-2-carbonyl)piperazin-1-yl]methylidene]amino]heptanoate |
|---|---|
| PubChem CID | 111168617 |
| Molecular Formula | C21H34N4O4 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | ethyl 7-[[ethylamino-[4-(furan-2-carbonyl)piperazin-1-yl]methylidene]amino]heptanoate |
| SMILES | CCN/C(=N\CCCCCCC(=O)OCC)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C21H34N4O4/c1-3-22-21(23-12-8-6-5-7-11-19(26)28-4-2)25-15-13-24(14-16-25)20(27)18-10-9-17-29-18/h9-10,17H,3-8,11-16H2,1-2H3,(H,22,23) |
| InChIKey | FPSWVIZENKEWMQ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|