About 4-[(2R)-butan-2-yl]-1,2,4-dithiazolidine-3,5-dione
4-[(2R)-butan-2-yl]-1,2,4-dithiazolidine-3,5-dione (PubChem CID 11116864) has the molecular formula C6H9NO2S2
and a molecular weight of 191.28 g/mol. Its IUPAC name is 4-[(2R)-butan-2-yl]-1,2,4-dithiazolidine-3,5-dione.
Molecular Properties
| Compound Name | 4-[(2R)-butan-2-yl]-1,2,4-dithiazolidine-3,5-dione |
| PubChem CID | 11116864 |
| Molecular Formula | C6H9NO2S2 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.01 |
| IUPAC Name | 4-[(2R)-butan-2-yl]-1,2,4-dithiazolidine-3,5-dione |
| SMILES | CC[C@@H](C)n1c(=O)ssc1=O |
| InChI | InChI=1S/C6H9NO2S2/c1-3-4(2)7-5(8)10-11-6(7)9/h4H,3H2,1-2H3/t4-/m1/s1 |
| InChIKey | QGRDOCYSQNMAMH-SCSAIBSYSA-N |
| XLogP | 1.30 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(2R)-butan-2-yl]-1,2,4-dithiazolidine-3,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2R)-butan-2-yl]-1,2,4-dithiazolidine-3,5-dione?
The IUPAC name of 4-[(2R)-butan-2-yl]-1,2,4-dithiazolidine-3,5-dione (CID 11116864) is 4-[(2R)-butan-2-yl]-1,2,4-dithiazolidine-3,5-dione.
What is the SMILES notation for 4-[(2R)-butan-2-yl]-1,2,4-dithiazolidine-3,5-dione?
The canonical SMILES for 4-[(2R)-butan-2-yl]-1,2,4-dithiazolidine-3,5-dione is CC[C@@H](C)n1c(=O)ssc1=O.
What is the InChIKey of 4-[(2R)-butan-2-yl]-1,2,4-dithiazolidine-3,5-dione?
The InChIKey is QGRDOCYSQNMAMH-SCSAIBSYSA-N. The full InChI is InChI=1S/C6H9NO2S2/c1-3-4(2)7-5(8)10-11-6(7)9/h4H,3H2,1-2H3/t4-/m1/s1.
What are the key properties of 4-[(2R)-butan-2-yl]-1,2,4-dithiazolidine-3,5-dione?
4-[(2R)-butan-2-yl]-1,2,4-dithiazolidine-3,5-dione has a molecular weight of 191.28 g/mol, XLogP of 1.30, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2R)-butan-2-yl]-1,2,4-dithiazolidine-3,5-dione is sourced from PubChem (CID 11116864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).