About 3-chloronaphthalene-1,2-dione
3-chloronaphthalene-1,2-dione (PubChem CID 11116887) has the molecular formula C10H5ClO2
and a molecular weight of 192.60 g/mol. Its IUPAC name is 3-chloronaphthalene-1,2-dione.
Molecular Properties
| Compound Name | 3-chloronaphthalene-1,2-dione |
| PubChem CID | 11116887 |
| Molecular Formula | C10H5ClO2 |
| Molecular Weight | 192.60 g/mol |
| Exact Mass | 192.00 |
| IUPAC Name | 3-chloronaphthalene-1,2-dione |
| SMILES | O=C1C(=O)c2ccccc2C=C1Cl |
| InChI | InChI=1S/C10H5ClO2/c11-8-5-6-3-1-2-4-7(6)9(12)10(8)13/h1-5H |
| InChIKey | MEMRDSMVFLMGRE-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.60 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-chloronaphthalene-1,2-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloronaphthalene-1,2-dione?
The IUPAC name of 3-chloronaphthalene-1,2-dione (CID 11116887) is 3-chloronaphthalene-1,2-dione.
What is the SMILES notation for 3-chloronaphthalene-1,2-dione?
The canonical SMILES for 3-chloronaphthalene-1,2-dione is O=C1C(=O)c2ccccc2C=C1Cl.
What is the InChIKey of 3-chloronaphthalene-1,2-dione?
The InChIKey is MEMRDSMVFLMGRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5ClO2/c11-8-5-6-3-1-2-4-7(6)9(12)10(8)13/h1-5H.
What are the key properties of 3-chloronaphthalene-1,2-dione?
3-chloronaphthalene-1,2-dione has a molecular weight of 192.60 g/mol, XLogP of 2.03, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloronaphthalene-1,2-dione is sourced from PubChem (CID 11116887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).