C9H8O5 — CID 11116956
methyl 5-methoxy-3,4-dioxocyclohexa-1,5-diene-1-carboxylate (PubChem CID 11116956) has the molecular formula C9H8O5 and a molecular weight of 196.16 g/mol. Its IUPAC name is methyl 5-methoxy-3,4-dioxocyclohexa-1,5-diene-1-carboxylate.
| Compound Name | methyl 5-methoxy-3,4-dioxocyclohexa-1,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 11116956 |
| Molecular Formula | C9H8O5 |
| Molecular Weight | 196.16 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | methyl 5-methoxy-3,4-dioxocyclohexa-1,5-diene-1-carboxylate |
| SMILES | COC(=O)C1=CC(=O)C(=O)C(OC)=C1 |
| InChI | InChI=1S/C9H8O5/c1-13-7-4-5(9(12)14-2)3-6(10)8(7)11/h3-4H,1-2H3 |
| InChIKey | QNYKZVAVHLAZSM-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.16 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|