C24H33FIN5O2 — CID 111169577
1-[3-[4-(4-fluorophenyl)piperazin-1-yl]-3-oxopropyl]-3-[2-(4-methoxyphenyl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111169577) has the molecular formula C24H33FIN5O2 and a molecular weight of 569.46 g/mol. Its IUPAC name is 1-[3-[4-(4-fluorophenyl)piperazin-1-yl]-3-oxopropyl]-3-[2-(4-methoxyphenyl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[3-[4-(4-fluorophenyl)piperazin-1-yl]-3-oxopropyl]-3-[2-(4-methoxyphenyl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111169577 |
| Molecular Formula | C24H33FIN5O2 |
| Molecular Weight | 569.46 g/mol |
| Exact Mass | 569.17 |
| IUPAC Name | 1-[3-[4-(4-fluorophenyl)piperazin-1-yl]-3-oxopropyl]-3-[2-(4-methoxyphenyl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCC(=O)N1CCN(c2ccc(F)cc2)CC1)NCCc1ccc(OC)cc1.I |
| InChI | InChI=1S/C24H32FN5O2.HI/c1-26-24(27-13-11-19-3-9-22(32-2)10-4-19)28-14-12-23(31)30-17-15-29(16-18-30)21-7-5-20(25)6-8-21;/h3-10H,11-18H2,1-2H3,(H2,26,27,28);1H |
| InChIKey | JLUWBIFEDCONJE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|