C25H20O5 — CID 1111705
(3Z)-3-[(3,4-dimethoxyphenyl)methylidene]-5-(4-phenoxyphenyl)furan-2-one (PubChem CID 1111705) has the molecular formula C25H20O5 and a molecular weight of 400.43 g/mol. Its IUPAC name is (3Z)-3-[(3,4-dimethoxyphenyl)methylidene]-5-(4-phenoxyphenyl)furan-2-one.
| Compound Name | (3Z)-3-[(3,4-dimethoxyphenyl)methylidene]-5-(4-phenoxyphenyl)furan-2-one |
|---|---|
| PubChem CID | 1111705 |
| Molecular Formula | C25H20O5 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | (3Z)-3-[(3,4-dimethoxyphenyl)methylidene]-5-(4-phenoxyphenyl)furan-2-one |
| SMILES | COc1ccc(/C=C2/C=C(c3ccc(Oc4ccccc4)cc3)OC2=O)cc1OC |
| InChI | InChI=1S/C25H20O5/c1-27-22-13-8-17(15-24(22)28-2)14-19-16-23(30-25(19)26)18-9-11-21(12-10-18)29-20-6-4-3-5-7-20/h3-16H,1-2H3/b19-14- |
| InChIKey | CIHLXFLGWWGIDV-RGEXLXHISA-N |
| XLogP | 5.48 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|