About (2S,3S)-3-azido-4-phenylbutane-1,2-diol
(2S,3S)-3-azido-4-phenylbutane-1,2-diol (PubChem CID 11117244) has the molecular formula C10H13N3O2
and a molecular weight of 207.23 g/mol. Its IUPAC name is (2S,3S)-3-azido-4-phenylbutane-1,2-diol.
Molecular Properties
| Compound Name | (2S,3S)-3-azido-4-phenylbutane-1,2-diol |
| PubChem CID | 11117244 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | (2S,3S)-3-azido-4-phenylbutane-1,2-diol |
| SMILES | [N-]=[N+]=N[C@@H](Cc1ccccc1)[C@H](O)CO |
| InChI | InChI=1S/C10H13N3O2/c11-13-12-9(10(15)7-14)6-8-4-2-1-3-5-8/h1-5,9-10,14-15H,6-7H2/t9-,10+/m0/s1 |
| InChIKey | JTCZSTHUGMZUHS-VHSXEESVSA-N |
| XLogP | 1.26 |
| TPSA | 89.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (2S,3S)-3-azido-4-phenylbutane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S)-3-azido-4-phenylbutane-1,2-diol?
The IUPAC name of (2S,3S)-3-azido-4-phenylbutane-1,2-diol (CID 11117244) is (2S,3S)-3-azido-4-phenylbutane-1,2-diol.
What is the SMILES notation for (2S,3S)-3-azido-4-phenylbutane-1,2-diol?
The canonical SMILES for (2S,3S)-3-azido-4-phenylbutane-1,2-diol is [N-]=[N+]=N[C@@H](Cc1ccccc1)[C@H](O)CO.
What is the InChIKey of (2S,3S)-3-azido-4-phenylbutane-1,2-diol?
The InChIKey is JTCZSTHUGMZUHS-VHSXEESVSA-N. The full InChI is InChI=1S/C10H13N3O2/c11-13-12-9(10(15)7-14)6-8-4-2-1-3-5-8/h1-5,9-10,14-15H,6-7H2/t9-,10+/m0/s1.
What are the key properties of (2S,3S)-3-azido-4-phenylbutane-1,2-diol?
(2S,3S)-3-azido-4-phenylbutane-1,2-diol has a molecular weight of 207.23 g/mol, XLogP of 1.26, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-3-azido-4-phenylbutane-1,2-diol is sourced from PubChem (CID 11117244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).