C7H8N6O2 — CID 11117255
N,2-dimethyl-8-nitropyrazolo[1,5-a][1,3,5]triazin-4-amine (PubChem CID 11117255) has the molecular formula C7H8N6O2 and a molecular weight of 208.18 g/mol. Its IUPAC name is N,2-dimethyl-8-nitropyrazolo[1,5-a][1,3,5]triazin-4-amine.
| Compound Name | N,2-dimethyl-8-nitropyrazolo[1,5-a][1,3,5]triazin-4-amine |
|---|---|
| PubChem CID | 11117255 |
| Molecular Formula | C7H8N6O2 |
| Molecular Weight | 208.18 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | N,2-dimethyl-8-nitropyrazolo[1,5-a][1,3,5]triazin-4-amine |
| SMILES | CNc1nc(C)nc2c([N+](=O)[O-])cnn12 |
| InChI | InChI=1S/C7H8N6O2/c1-4-10-6-5(13(14)15)3-9-12(6)7(8-2)11-4/h3H,1-2H3,(H,8,10,11) |
| InChIKey | JHAJAIXUKCYFTL-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.18 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|