C11H15NO3 — CID 11117290
(3aR,9aR,9bS)-2,2-dimethyl-4,7,9a,9b-tetrahydro-3aH-[1,3]dioxolo[4,5-a]indolizin-6-one (PubChem CID 11117290) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is (3aR,9aR,9bS)-2,2-dimethyl-4,7,9a,9b-tetrahydro-3aH-[1,3]dioxolo[4,5-a]indolizin-6-one.
| Compound Name | (3aR,9aR,9bS)-2,2-dimethyl-4,7,9a,9b-tetrahydro-3aH-[1,3]dioxolo[4,5-a]indolizin-6-one |
|---|---|
| PubChem CID | 11117290 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | (3aR,9aR,9bS)-2,2-dimethyl-4,7,9a,9b-tetrahydro-3aH-[1,3]dioxolo[4,5-a]indolizin-6-one |
| SMILES | CC1(C)O[C@H]2[C@H]3C=CCC(=O)N3C[C@H]2O1 |
| InChI | InChI=1S/C11H15NO3/c1-11(2)14-8-6-12-7(10(8)15-11)4-3-5-9(12)13/h3-4,7-8,10H,5-6H2,1-2H3/t7-,8-,10+/m1/s1 |
| InChIKey | SKWANCUVZHUHIT-MRTMQBJTSA-N |
| XLogP | 0.68 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|