C14H28O — CID 11117370
(4R,5S)-4-tert-butyl-2-methylnon-2-en-5-ol (PubChem CID 11117370) has the molecular formula C14H28O and a molecular weight of 212.38 g/mol. Its IUPAC name is (4R,5S)-4-tert-butyl-2-methylnon-2-en-5-ol.
| Compound Name | (4R,5S)-4-tert-butyl-2-methylnon-2-en-5-ol |
|---|---|
| PubChem CID | 11117370 |
| Molecular Formula | C14H28O |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.21 |
| IUPAC Name | (4R,5S)-4-tert-butyl-2-methylnon-2-en-5-ol |
| SMILES | CCCC[C@H](O)[C@H](C=C(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H28O/c1-7-8-9-13(15)12(10-11(2)3)14(4,5)6/h10,12-13,15H,7-9H2,1-6H3/t12-,13-/m0/s1 |
| InChIKey | IBYZMNBLOXRTRQ-STQMWFEESA-N |
| XLogP | 4.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|