C19H25ClIN3O — CID 111174107
2-[(2-chlorophenyl)methyl]-1-ethyl-3-(2-hydroxy-3-phenylpropyl)guanidine;hydroiodide (PubChem CID 111174107) has the molecular formula C19H25ClIN3O and a molecular weight of 473.79 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl]-1-ethyl-3-(2-hydroxy-3-phenylpropyl)guanidine;hydroiodide.
| Compound Name | 2-[(2-chlorophenyl)methyl]-1-ethyl-3-(2-hydroxy-3-phenylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111174107 |
| Molecular Formula | C19H25ClIN3O |
| Molecular Weight | 473.79 g/mol |
| Exact Mass | 473.07 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl]-1-ethyl-3-(2-hydroxy-3-phenylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1Cl)NCC(O)Cc1ccccc1.I |
| InChI | InChI=1S/C19H24ClN3O.HI/c1-2-21-19(22-13-16-10-6-7-11-18(16)20)23-14-17(24)12-15-8-4-3-5-9-15;/h3-11,17,24H,2,12-14H2,1H3,(H2,21,22,23);1H |
| InChIKey | DPPTWSTXPBBTFI-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.79 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|