About N,N-dimethyl-2,6-bis(methylsulfanyl)pyridin-4-amine
N,N-dimethyl-2,6-bis(methylsulfanyl)pyridin-4-amine (PubChem CID 11117414) has the molecular formula C9H14N2S2
and a molecular weight of 214.36 g/mol. Its IUPAC name is N,N-dimethyl-2,6-bis(methylsulfanyl)pyridin-4-amine.
Analyze N,N-dimethyl-2,6-bis(methylsulfanyl)pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-2,6-bis(methylsulfanyl)pyridin-4-amine?
The IUPAC name of N,N-dimethyl-2,6-bis(methylsulfanyl)pyridin-4-amine (CID 11117414) is N,N-dimethyl-2,6-bis(methylsulfanyl)pyridin-4-amine.
What is the SMILES notation for N,N-dimethyl-2,6-bis(methylsulfanyl)pyridin-4-amine?
The canonical SMILES for N,N-dimethyl-2,6-bis(methylsulfanyl)pyridin-4-amine is CSc1cc(N(C)C)cc(SC)n1.
What is the InChIKey of N,N-dimethyl-2,6-bis(methylsulfanyl)pyridin-4-amine?
The InChIKey is JYHRYFQSEQOUBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2S2/c1-11(2)7-5-8(12-3)10-9(6-7)13-4/h5-6H,1-4H3.
What are the key properties of N,N-dimethyl-2,6-bis(methylsulfanyl)pyridin-4-amine?
N,N-dimethyl-2,6-bis(methylsulfanyl)pyridin-4-amine has a molecular weight of 214.36 g/mol, XLogP of 2.59, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-2,6-bis(methylsulfanyl)pyridin-4-amine is sourced from PubChem (CID 11117414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).