C15H21ClIN5 — CID 111174509
1-[(2-chlorophenyl)methyl]-3-ethyl-2-[(1-methylpyrazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111174509) has the molecular formula C15H21ClIN5 and a molecular weight of 433.73 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-3-ethyl-2-[(1-methylpyrazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(2-chlorophenyl)methyl]-3-ethyl-2-[(1-methylpyrazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111174509 |
| Molecular Formula | C15H21ClIN5 |
| Molecular Weight | 433.73 g/mol |
| Exact Mass | 433.05 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-3-ethyl-2-[(1-methylpyrazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cnn(C)c1)NCc1ccccc1Cl.I |
| InChI | InChI=1S/C15H20ClN5.HI/c1-3-17-15(18-8-12-9-20-21(2)11-12)19-10-13-6-4-5-7-14(13)16;/h4-7,9,11H,3,8,10H2,1-2H3,(H2,17,18,19);1H |
| InChIKey | XHKSQVYDHIFSNS-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.73 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|