C19H25ClIN5O — CID 111175316
3-[[N'-[(2-chlorophenyl)methyl]-N-ethylcarbamimidoyl]amino]-N-(5-methyl-2-pyridinyl)propanamide;hydroiodide (PubChem CID 111175316) has the molecular formula C19H25ClIN5O and a molecular weight of 501.80 g/mol. Its IUPAC name is 3-[[N'-[(2-chlorophenyl)methyl]-N-ethylcarbamimidoyl]amino]-N-(5-methyl-2-pyridinyl)propanamide;hydroiodide.
| Compound Name | 3-[[N'-[(2-chlorophenyl)methyl]-N-ethylcarbamimidoyl]amino]-N-(5-methyl-2-pyridinyl)propanamide;hydroiodide |
|---|---|
| PubChem CID | 111175316 |
| Molecular Formula | C19H25ClIN5O |
| Molecular Weight | 501.80 g/mol |
| Exact Mass | 501.08 |
| IUPAC Name | 3-[[N'-[(2-chlorophenyl)methyl]-N-ethylcarbamimidoyl]amino]-N-(5-methyl-2-pyridinyl)propanamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1Cl)NCCC(=O)Nc1ccc(C)cn1.I |
| InChI | InChI=1S/C19H24ClN5O.HI/c1-3-21-19(24-13-15-6-4-5-7-16(15)20)22-11-10-18(26)25-17-9-8-14(2)12-23-17;/h4-9,12H,3,10-11,13H2,1-2H3,(H2,21,22,24)(H,23,25,26);1H |
| InChIKey | QXZXOSNLLYAIQF-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.80 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|