C20H34ClN5 — CID 111175681
2-[(2-chlorophenyl)methyl]-1-ethyl-3-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]guanidine (PubChem CID 111175681) has the molecular formula C20H34ClN5 and a molecular weight of 379.98 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl]-1-ethyl-3-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]guanidine.
| Compound Name | 2-[(2-chlorophenyl)methyl]-1-ethyl-3-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]guanidine |
|---|---|
| PubChem CID | 111175681 |
| Molecular Formula | C20H34ClN5 |
| Molecular Weight | 379.98 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl]-1-ethyl-3-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccccc1Cl)NCC(C)CN1CCN(CC)CC1 |
| InChI | InChI=1S/C20H34ClN5/c1-4-22-20(24-15-18-8-6-7-9-19(18)21)23-14-17(3)16-26-12-10-25(5-2)11-13-26/h6-9,17H,4-5,10-16H2,1-3H3,(H2,22,23,24) |
| InChIKey | AHOBAXDFKACDKQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.98 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|