C19H26ClIN4O2S — CID 111176667
1-[2-(benzylsulfamoyl)ethyl]-2-[(3-chlorophenyl)methyl]-3-ethylguanidine;hydroiodide (PubChem CID 111176667) has the molecular formula C19H26ClIN4O2S and a molecular weight of 536.87 g/mol. Its IUPAC name is 1-[2-(benzylsulfamoyl)ethyl]-2-[(3-chlorophenyl)methyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 1-[2-(benzylsulfamoyl)ethyl]-2-[(3-chlorophenyl)methyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111176667 |
| Molecular Formula | C19H26ClIN4O2S |
| Molecular Weight | 536.87 g/mol |
| Exact Mass | 536.05 |
| IUPAC Name | 1-[2-(benzylsulfamoyl)ethyl]-2-[(3-chlorophenyl)methyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(Cl)c1)NCCS(=O)(=O)NCc1ccccc1.I |
| InChI | InChI=1S/C19H25ClN4O2S.HI/c1-2-21-19(23-14-17-9-6-10-18(20)13-17)22-11-12-27(25,26)24-15-16-7-4-3-5-8-16;/h3-10,13,24H,2,11-12,14-15H2,1H3,(H2,21,22,23);1H |
| InChIKey | FTFIQZRXTFFALS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.87 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|