C12H17NO3 — CID 11117669
(1S,2R,3R,4S)-1-benzyl-2-methyl-1-oxidopyrrolidin-1-ium-3,4-diol (PubChem CID 11117669) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is (1S,2R,3R,4S)-1-benzyl-2-methyl-1-oxidopyrrolidin-1-ium-3,4-diol.
| Compound Name | (1S,2R,3R,4S)-1-benzyl-2-methyl-1-oxidopyrrolidin-1-ium-3,4-diol |
|---|---|
| PubChem CID | 11117669 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | (1S,2R,3R,4S)-1-benzyl-2-methyl-1-oxidopyrrolidin-1-ium-3,4-diol |
| SMILES | C[C@@H]1[C@@H](O)[C@@H](O)C[N@@+]1([O-])Cc1ccccc1 |
| InChI | InChI=1S/C12H17NO3/c1-9-12(15)11(14)8-13(9,16)7-10-5-3-2-4-6-10/h2-6,9,11-12,14-15H,7-8H2,1H3/t9-,11+,12-,13+/m1/s1 |
| InChIKey | NWBFMGGSRIEWGK-MGAJPHDKSA-N |
| XLogP | 0.63 |
| TPSA | 63.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|