About 10-ethenyl-3,3-dimethyl-2,4-dioxaspiro[5.5]undec-10-en-8-ol
10-ethenyl-3,3-dimethyl-2,4-dioxaspiro[5.5]undec-10-en-8-ol (PubChem CID 11117694) has the molecular formula C13H20O3
and a molecular weight of 224.30 g/mol. Its IUPAC name is 10-ethenyl-3,3-dimethyl-2,4-dioxaspiro[5.5]undec-10-en-8-ol.
Molecular Properties
| Compound Name | 10-ethenyl-3,3-dimethyl-2,4-dioxaspiro[5.5]undec-10-en-8-ol |
| PubChem CID | 11117694 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 10-ethenyl-3,3-dimethyl-2,4-dioxaspiro[5.5]undec-10-en-8-ol |
| SMILES | C=CC1=CC2(COC(C)(C)OC2)CC(O)C1 |
| InChI | InChI=1S/C13H20O3/c1-4-10-5-11(14)7-13(6-10)8-15-12(2,3)16-9-13/h4,6,11,14H,1,5,7-9H2,2-3H3 |
| InChIKey | VPOGBSKXOBKGKH-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 10-ethenyl-3,3-dimethyl-2,4-dioxaspiro[5.5]undec-10-en-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-ethenyl-3,3-dimethyl-2,4-dioxaspiro[5.5]undec-10-en-8-ol?
The IUPAC name of 10-ethenyl-3,3-dimethyl-2,4-dioxaspiro[5.5]undec-10-en-8-ol (CID 11117694) is 10-ethenyl-3,3-dimethyl-2,4-dioxaspiro[5.5]undec-10-en-8-ol.
What is the SMILES notation for 10-ethenyl-3,3-dimethyl-2,4-dioxaspiro[5.5]undec-10-en-8-ol?
The canonical SMILES for 10-ethenyl-3,3-dimethyl-2,4-dioxaspiro[5.5]undec-10-en-8-ol is C=CC1=CC2(COC(C)(C)OC2)CC(O)C1.
What is the InChIKey of 10-ethenyl-3,3-dimethyl-2,4-dioxaspiro[5.5]undec-10-en-8-ol?
The InChIKey is VPOGBSKXOBKGKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O3/c1-4-10-5-11(14)7-13(6-10)8-15-12(2,3)16-9-13/h4,6,11,14H,1,5,7-9H2,2-3H3.
What are the key properties of 10-ethenyl-3,3-dimethyl-2,4-dioxaspiro[5.5]undec-10-en-8-ol?
10-ethenyl-3,3-dimethyl-2,4-dioxaspiro[5.5]undec-10-en-8-ol has a molecular weight of 224.30 g/mol, XLogP of 2.02, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10-ethenyl-3,3-dimethyl-2,4-dioxaspiro[5.5]undec-10-en-8-ol is sourced from PubChem (CID 11117694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).