C10H8F2N2S — CID 11117740
2,4-difluoro-5-(2-methyl-1,3-thiazol-4-yl)aniline (PubChem CID 11117740) has the molecular formula C10H8F2N2S and a molecular weight of 226.25 g/mol. Its IUPAC name is 2,4-difluoro-5-(2-methyl-1,3-thiazol-4-yl)aniline.
| Compound Name | 2,4-difluoro-5-(2-methyl-1,3-thiazol-4-yl)aniline |
|---|---|
| PubChem CID | 11117740 |
| Molecular Formula | C10H8F2N2S |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | 2,4-difluoro-5-(2-methyl-1,3-thiazol-4-yl)aniline |
| SMILES | Cc1nc(-c2cc(N)c(F)cc2F)cs1 |
| InChI | InChI=1S/C10H8F2N2S/c1-5-14-10(4-15-5)6-2-9(13)8(12)3-7(6)11/h2-4H,13H2,1H3 |
| InChIKey | HVHWIASXPUYAKC-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|