C14H10OS — CID 11117751
2-phenyl-1-benzothiophen-6-ol (PubChem CID 11117751) has the molecular formula C14H10OS and a molecular weight of 226.30 g/mol. Its IUPAC name is 2-phenyl-1-benzothiophen-6-ol.
| Compound Name | 2-phenyl-1-benzothiophen-6-ol |
|---|---|
| PubChem CID | 11117751 |
| Molecular Formula | C14H10OS |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 2-phenyl-1-benzothiophen-6-ol |
| SMILES | Oc1ccc2cc(-c3ccccc3)sc2c1 |
| InChI | InChI=1S/C14H10OS/c15-12-7-6-11-8-13(16-14(11)9-12)10-4-2-1-3-5-10/h1-9,15H |
| InChIKey | BTCAHHDEULKYID-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |