C10H11BrO — CID 11117768
(1S,2S)-2-bromo-1,2,3,4-tetrahydronaphthalen-1-ol (PubChem CID 11117768) has the molecular formula C10H11BrO and a molecular weight of 227.10 g/mol. Its IUPAC name is (1S,2S)-2-bromo-1,2,3,4-tetrahydronaphthalen-1-ol.
| Compound Name | (1S,2S)-2-bromo-1,2,3,4-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 11117768 |
| Molecular Formula | C10H11BrO |
| Molecular Weight | 227.10 g/mol |
| Exact Mass | 226.00 |
| IUPAC Name | (1S,2S)-2-bromo-1,2,3,4-tetrahydronaphthalen-1-ol |
| SMILES | O[C@H]1c2ccccc2CC[C@@H]1Br |
| InChI | InChI=1S/C10H11BrO/c11-9-6-5-7-3-1-2-4-8(7)10(9)12/h1-4,9-10,12H,5-6H2/t9-,10-/m0/s1 |
| InChIKey | OTLLBSSGPSQQJY-UWVGGRQHSA-N |
| XLogP | 2.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.10 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|