C10H23N3O2S — CID 111178214
2-methyl-1-(2-methylpropyl)-3-(3-methylsulfonylpropyl)guanidine (PubChem CID 111178214) has the molecular formula C10H23N3O2S and a molecular weight of 249.38 g/mol. Its IUPAC name is 2-methyl-1-(2-methylpropyl)-3-(3-methylsulfonylpropyl)guanidine.
| Compound Name | 2-methyl-1-(2-methylpropyl)-3-(3-methylsulfonylpropyl)guanidine |
|---|---|
| PubChem CID | 111178214 |
| Molecular Formula | C10H23N3O2S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 2-methyl-1-(2-methylpropyl)-3-(3-methylsulfonylpropyl)guanidine |
| SMILES | C/N=C(/NCCCS(C)(=O)=O)NCC(C)C |
| InChI | InChI=1S/C10H23N3O2S/c1-9(2)8-13-10(11-3)12-6-5-7-16(4,14)15/h9H,5-8H2,1-4H3,(H2,11,12,13) |
| InChIKey | XIIAFUALWNTXPX-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|