C15H18O2 — CID 11117870
(9aS,9bR)-3,6,9-trimethyl-5,7,9a,9b-tetrahydro-4H-azuleno[4,5-b]furan-2-one (PubChem CID 11117870) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is (9aS,9bR)-3,6,9-trimethyl-5,7,9a,9b-tetrahydro-4H-azuleno[4,5-b]furan-2-one.
| Compound Name | (9aS,9bR)-3,6,9-trimethyl-5,7,9a,9b-tetrahydro-4H-azuleno[4,5-b]furan-2-one |
|---|---|
| PubChem CID | 11117870 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | (9aS,9bR)-3,6,9-trimethyl-5,7,9a,9b-tetrahydro-4H-azuleno[4,5-b]furan-2-one |
| SMILES | CC1=CCC2=C(C)CCC3=C(C)C(=O)O[C@@H]3[C@@H]12 |
| InChI | InChI=1S/C15H18O2/c1-8-4-7-12-10(3)15(16)17-14(12)13-9(2)5-6-11(8)13/h5,13-14H,4,6-7H2,1-3H3/t13-,14-/m0/s1 |
| InChIKey | FRPSUTLKKACGJQ-KBPBESRZSA-N |
| XLogP | 3.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|