About 2-bromo-6-methoxybenzoic acid
2-bromo-6-methoxybenzoic acid (PubChem CID 11117881) has the molecular formula C8H7BrO3
and a molecular weight of 231.04 g/mol. Its IUPAC name is 2-bromo-6-methoxybenzoic acid.
Molecular Properties
| Compound Name | 2-bromo-6-methoxybenzoic acid |
| PubChem CID | 11117881 |
| Molecular Formula | C8H7BrO3 |
| Molecular Weight | 231.04 g/mol |
| Exact Mass | 229.96 |
| IUPAC Name | 2-bromo-6-methoxybenzoic acid |
| SMILES | COc1cccc(Br)c1C(=O)O |
| InChI | InChI=1S/C8H7BrO3/c1-12-6-4-2-3-5(9)7(6)8(10)11/h2-4H,1H3,(H,10,11) |
| InChIKey | BNYFDICJYCBPRW-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.04 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-bromo-6-methoxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-6-methoxybenzoic acid?
The IUPAC name of 2-bromo-6-methoxybenzoic acid (CID 11117881) is 2-bromo-6-methoxybenzoic acid.
What is the SMILES notation for 2-bromo-6-methoxybenzoic acid?
The canonical SMILES for 2-bromo-6-methoxybenzoic acid is COc1cccc(Br)c1C(=O)O.
What is the InChIKey of 2-bromo-6-methoxybenzoic acid?
The InChIKey is BNYFDICJYCBPRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrO3/c1-12-6-4-2-3-5(9)7(6)8(10)11/h2-4H,1H3,(H,10,11).
What are the key properties of 2-bromo-6-methoxybenzoic acid?
2-bromo-6-methoxybenzoic acid has a molecular weight of 231.04 g/mol, XLogP of 2.16, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-6-methoxybenzoic acid is sourced from PubChem (CID 11117881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).