About 6-piperazin-1-yl-3,4-dihydro-1H-quinolin-2-one
6-piperazin-1-yl-3,4-dihydro-1H-quinolin-2-one (PubChem CID 11117896) has the molecular formula C13H17N3O
and a molecular weight of 231.30 g/mol. Its IUPAC name is 6-piperazin-1-yl-3,4-dihydro-1H-quinolin-2-one.
Molecular Properties
| Compound Name | 6-piperazin-1-yl-3,4-dihydro-1H-quinolin-2-one |
| PubChem CID | 11117896 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 6-piperazin-1-yl-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(N3CCNCC3)ccc2N1 |
| InChI | InChI=1S/C13H17N3O/c17-13-4-1-10-9-11(2-3-12(10)15-13)16-7-5-14-6-8-16/h2-3,9,14H,1,4-8H2,(H,15,17) |
| InChIKey | FSQOWYCPSKDQHL-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze 6-piperazin-1-yl-3,4-dihydro-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-piperazin-1-yl-3,4-dihydro-1H-quinolin-2-one?
The IUPAC name of 6-piperazin-1-yl-3,4-dihydro-1H-quinolin-2-one (CID 11117896) is 6-piperazin-1-yl-3,4-dihydro-1H-quinolin-2-one.
What is the SMILES notation for 6-piperazin-1-yl-3,4-dihydro-1H-quinolin-2-one?
The canonical SMILES for 6-piperazin-1-yl-3,4-dihydro-1H-quinolin-2-one is O=C1CCc2cc(N3CCNCC3)ccc2N1.
What is the InChIKey of 6-piperazin-1-yl-3,4-dihydro-1H-quinolin-2-one?
The InChIKey is FSQOWYCPSKDQHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O/c17-13-4-1-10-9-11(2-3-12(10)15-13)16-7-5-14-6-8-16/h2-3,9,14H,1,4-8H2,(H,15,17).
What are the key properties of 6-piperazin-1-yl-3,4-dihydro-1H-quinolin-2-one?
6-piperazin-1-yl-3,4-dihydro-1H-quinolin-2-one has a molecular weight of 231.30 g/mol, XLogP of 0.98, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-piperazin-1-yl-3,4-dihydro-1H-quinolin-2-one is sourced from PubChem (CID 11117896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).