C12H11NO4 — CID 11117948
3-hydroxy-7-methoxy-1,2,3,4-tetrahydrocyclopenta[b]indole-5,8-dione (PubChem CID 11117948) has the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. Its IUPAC name is 3-hydroxy-7-methoxy-1,2,3,4-tetrahydrocyclopenta[b]indole-5,8-dione.
| Compound Name | 3-hydroxy-7-methoxy-1,2,3,4-tetrahydrocyclopenta[b]indole-5,8-dione |
|---|---|
| PubChem CID | 11117948 |
| Molecular Formula | C12H11NO4 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 3-hydroxy-7-methoxy-1,2,3,4-tetrahydrocyclopenta[b]indole-5,8-dione |
| SMILES | COC1=CC(=O)c2[nH]c3c(c2C1=O)CCC3O |
| InChI | InChI=1S/C12H11NO4/c1-17-8-4-7(15)11-9(12(8)16)5-2-3-6(14)10(5)13-11/h4,6,13-14H,2-3H2,1H3 |
| InChIKey | CWNFGVTUGFTUHP-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|