C14H30N4O — CID 111179527
N-butan-2-yl-3-[[N-ethyl-N'-(2-methylpropyl)carbamimidoyl]amino]propanamide (PubChem CID 111179527) has the molecular formula C14H30N4O and a molecular weight of 270.42 g/mol. Its IUPAC name is N-butan-2-yl-3-[[N-ethyl-N'-(2-methylpropyl)carbamimidoyl]amino]propanamide.
| Compound Name | N-butan-2-yl-3-[[N-ethyl-N'-(2-methylpropyl)carbamimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 111179527 |
| Molecular Formula | C14H30N4O |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.24 |
| IUPAC Name | N-butan-2-yl-3-[[N-ethyl-N'-(2-methylpropyl)carbamimidoyl]amino]propanamide |
| SMILES | CCN/C(=N\CC(C)C)NCCC(=O)NC(C)CC |
| InChI | InChI=1S/C14H30N4O/c1-6-12(5)18-13(19)8-9-16-14(15-7-2)17-10-11(3)4/h11-12H,6-10H2,1-5H3,(H,18,19)(H2,15,16,17) |
| InChIKey | RHWXPHWJOBMSGW-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|