About 5-nitro-2-propoxyaniline
5-nitro-2-propoxyaniline (PubChem CID 11118) has the molecular formula C9H12N2O3
and a molecular weight of 196.21 g/mol. Its IUPAC name is 5-nitro-2-propoxyaniline.
Molecular Properties
| Compound Name | 5-nitro-2-propoxyaniline |
| PubChem CID | 11118 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 5-nitro-2-propoxyaniline |
| SMILES | CCCOc1ccc([N+](=O)[O-])cc1N |
| InChI | InChI=1S/C9H12N2O3/c1-2-5-14-9-4-3-7(11(12)13)6-8(9)10/h3-4,6H,2,5,10H2,1H3 |
| InChIKey | RXQCEGOUSFBKPI-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitro-2-propoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitro-2-propoxyaniline?
The IUPAC name of 5-nitro-2-propoxyaniline (CID 11118) is 5-nitro-2-propoxyaniline.
What is the SMILES notation for 5-nitro-2-propoxyaniline?
The canonical SMILES for 5-nitro-2-propoxyaniline is CCCOc1ccc([N+](=O)[O-])cc1N.
What is the InChIKey of 5-nitro-2-propoxyaniline?
The InChIKey is RXQCEGOUSFBKPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O3/c1-2-5-14-9-4-3-7(11(12)13)6-8(9)10/h3-4,6H,2,5,10H2,1H3.
What are the key properties of 5-nitro-2-propoxyaniline?
5-nitro-2-propoxyaniline has a molecular weight of 196.21 g/mol, XLogP of 1.97, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitro-2-propoxyaniline is sourced from PubChem (CID 11118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).