C16H27IN4O2 — CID 111180092
N-[3-[2-[[N'-methyl-N-(2-methylpropyl)carbamimidoyl]amino]ethoxy]phenyl]acetamide;hydroiodide (PubChem CID 111180092) has the molecular formula C16H27IN4O2 and a molecular weight of 434.32 g/mol. Its IUPAC name is N-[3-[2-[[N'-methyl-N-(2-methylpropyl)carbamimidoyl]amino]ethoxy]phenyl]acetamide;hydroiodide.
| Compound Name | N-[3-[2-[[N'-methyl-N-(2-methylpropyl)carbamimidoyl]amino]ethoxy]phenyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111180092 |
| Molecular Formula | C16H27IN4O2 |
| Molecular Weight | 434.32 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | N-[3-[2-[[N'-methyl-N-(2-methylpropyl)carbamimidoyl]amino]ethoxy]phenyl]acetamide;hydroiodide |
| SMILES | C/N=C(/NCCOc1cccc(NC(C)=O)c1)NCC(C)C.I |
| InChI | InChI=1S/C16H26N4O2.HI/c1-12(2)11-19-16(17-4)18-8-9-22-15-7-5-6-14(10-15)20-13(3)21;/h5-7,10,12H,8-9,11H2,1-4H3,(H,20,21)(H2,17,18,19);1H |
| InChIKey | GHMYQRZYRNICCT-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.32 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|