C21H31IN4O3 — CID 111181346
1-[(4-methoxyphenyl)methyl]-2-methyl-3-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]guanidine;hydroiodide (PubChem CID 111181346) has the molecular formula C21H31IN4O3 and a molecular weight of 514.41 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-2-methyl-3-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]guanidine;hydroiodide.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-2-methyl-3-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111181346 |
| Molecular Formula | C21H31IN4O3 |
| Molecular Weight | 514.41 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-2-methyl-3-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(OC)cc1)NCC(c1ccc(C)o1)N1CCOCC1.I |
| InChI | InChI=1S/C21H30N4O3.HI/c1-16-4-9-20(28-16)19(25-10-12-27-13-11-25)15-24-21(22-2)23-14-17-5-7-18(26-3)8-6-17;/h4-9,19H,10-15H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | MQQMPXFWVSXTDU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|