About trans-(1S,2S)-1-ethoxy-2-iodocyclopentane
trans-(1S,2S)-1-ethoxy-2-iodocyclopentane (PubChem CID 11118152) has the molecular formula C7H13IO
and a molecular weight of 240.08 g/mol. Its IUPAC name is trans-(1S,2S)-1-ethoxy-2-iodocyclopentane.
Molecular Properties
| Compound Name | trans-(1S,2S)-1-ethoxy-2-iodocyclopentane |
| PubChem CID | 11118152 |
| Molecular Formula | C7H13IO |
| Molecular Weight | 240.08 g/mol |
| Exact Mass | 240.00 |
| IUPAC Name | trans-(1S,2S)-1-ethoxy-2-iodocyclopentane |
| SMILES | CCO[C@H]1CCC[C@@H]1I |
| InChI | InChI=1S/C7H13IO/c1-2-9-7-5-3-4-6(7)8/h6-7H,2-5H2,1H3/t6-,7-/m0/s1 |
| InChIKey | BGUFKZDYVKFYJP-BQBZGAKWSA-N |
| XLogP | 2.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.08 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze trans-(1S,2S)-1-ethoxy-2-iodocyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1S,2S)-1-ethoxy-2-iodocyclopentane?
The IUPAC name of trans-(1S,2S)-1-ethoxy-2-iodocyclopentane (CID 11118152) is trans-(1S,2S)-1-ethoxy-2-iodocyclopentane.
What is the SMILES notation for trans-(1S,2S)-1-ethoxy-2-iodocyclopentane?
The canonical SMILES for trans-(1S,2S)-1-ethoxy-2-iodocyclopentane is CCO[C@H]1CCC[C@@H]1I.
What is the InChIKey of trans-(1S,2S)-1-ethoxy-2-iodocyclopentane?
The InChIKey is BGUFKZDYVKFYJP-BQBZGAKWSA-N. The full InChI is InChI=1S/C7H13IO/c1-2-9-7-5-3-4-6(7)8/h6-7H,2-5H2,1H3/t6-,7-/m0/s1.
What are the key properties of trans-(1S,2S)-1-ethoxy-2-iodocyclopentane?
trans-(1S,2S)-1-ethoxy-2-iodocyclopentane has a molecular weight of 240.08 g/mol, XLogP of 2.38, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1S,2S)-1-ethoxy-2-iodocyclopentane is sourced from PubChem (CID 11118152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).