C20H23N7O2S — CID 1111827
N-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-4-phenyl-1,3-thiazol-2-amine (PubChem CID 1111827) has the molecular formula C20H23N7O2S and a molecular weight of 425.52 g/mol. Its IUPAC name is N-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-4-phenyl-1,3-thiazol-2-amine.
| Compound Name | N-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-4-phenyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 1111827 |
| Molecular Formula | C20H23N7O2S |
| Molecular Weight | 425.52 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | N-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-4-phenyl-1,3-thiazol-2-amine |
| SMILES | c1ccc(-c2csc(Nc3nc(N4CCOCC4)nc(N4CCOCC4)n3)n2)cc1 |
| InChI | InChI=1S/C20H23N7O2S/c1-2-4-15(5-3-1)16-14-30-20(21-16)24-17-22-18(26-6-10-28-11-7-26)25-19(23-17)27-8-12-29-13-9-27/h1-5,14H,6-13H2,(H,21,22,23,24,25) |
| InChIKey | XYQLZFGNBLPSGG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 88.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.52 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |