C20H27IN4O3 — CID 111182793
N-[2-[[N-ethyl-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]ethyl]-2-hydroxybenzamide;hydroiodide (PubChem CID 111182793) has the molecular formula C20H27IN4O3 and a molecular weight of 498.37 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]ethyl]-2-hydroxybenzamide;hydroiodide.
| Compound Name | N-[2-[[N-ethyl-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]ethyl]-2-hydroxybenzamide;hydroiodide |
|---|---|
| PubChem CID | 111182793 |
| Molecular Formula | C20H27IN4O3 |
| Molecular Weight | 498.37 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | N-[2-[[N-ethyl-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]ethyl]-2-hydroxybenzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OC)cc1)NCCNC(=O)c1ccccc1O.I |
| InChI | InChI=1S/C20H26N4O3.HI/c1-3-21-20(24-14-15-8-10-16(27-2)11-9-15)23-13-12-22-19(26)17-6-4-5-7-18(17)25;/h4-11,25H,3,12-14H2,1-2H3,(H,22,26)(H2,21,23,24);1H |
| InChIKey | GNKTZFULQOFQTK-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|