C12H10N2O4 — CID 11118321
3-(4-nitrocyclohexa-1,2,3,5-tetraen-1-yl)-4,5,6,7a-tetrahydro-3aH-pyrano[3,2-d][1,2]oxazole (PubChem CID 11118321) has the molecular formula C12H10N2O4 and a molecular weight of 246.22 g/mol. Its IUPAC name is 3-(4-nitrocyclohexa-1,2,3,5-tetraen-1-yl)-4,5,6,7a-tetrahydro-3aH-pyrano[3,2-d][1,2]oxazole.
| Compound Name | 3-(4-nitrocyclohexa-1,2,3,5-tetraen-1-yl)-4,5,6,7a-tetrahydro-3aH-pyrano[3,2-d][1,2]oxazole |
|---|---|
| PubChem CID | 11118321 |
| Molecular Formula | C12H10N2O4 |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 3-(4-nitrocyclohexa-1,2,3,5-tetraen-1-yl)-4,5,6,7a-tetrahydro-3aH-pyrano[3,2-d][1,2]oxazole |
| SMILES | O=[N+]([O-])C1=C=C=C(C2=NOC3OCCCC23)C=C1 |
| InChI | InChI=1S/C12H10N2O4/c15-14(16)9-5-3-8(4-6-9)11-10-2-1-7-17-12(10)18-13-11/h3,5,10,12H,1-2,7H2 |
| InChIKey | PLCNCCKARXVAKU-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 73.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|