C17H28IN3O3 — CID 111183903
ethyl 4-[[N-ethyl-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]butanoate;hydroiodide (PubChem CID 111183903) has the molecular formula C17H28IN3O3 and a molecular weight of 449.33 g/mol. Its IUPAC name is ethyl 4-[[N-ethyl-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]butanoate;hydroiodide.
| Compound Name | ethyl 4-[[N-ethyl-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]butanoate;hydroiodide |
|---|---|
| PubChem CID | 111183903 |
| Molecular Formula | C17H28IN3O3 |
| Molecular Weight | 449.33 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | ethyl 4-[[N-ethyl-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]butanoate;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OC)cc1)NCCCC(=O)OCC.I |
| InChI | InChI=1S/C17H27N3O3.HI/c1-4-18-17(19-12-6-7-16(21)23-5-2)20-13-14-8-10-15(22-3)11-9-14;/h8-11H,4-7,12-13H2,1-3H3,(H2,18,19,20);1H |
| InChIKey | KJCBRUHOAGYKQJ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|