C21H28N4O2 — CID 111184422
4-(2-hydroxyphenyl)-N'-methyl-N-[2-(2-methylphenoxy)ethyl]piperazine-1-carboximidamide (PubChem CID 111184422) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is 4-(2-hydroxyphenyl)-N'-methyl-N-[2-(2-methylphenoxy)ethyl]piperazine-1-carboximidamide.
| Compound Name | 4-(2-hydroxyphenyl)-N'-methyl-N-[2-(2-methylphenoxy)ethyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111184422 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 4-(2-hydroxyphenyl)-N'-methyl-N-[2-(2-methylphenoxy)ethyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCOc1ccccc1C)N1CCN(c2ccccc2O)CC1 |
| InChI | InChI=1S/C21H28N4O2/c1-17-7-3-6-10-20(17)27-16-11-23-21(22-2)25-14-12-24(13-15-25)18-8-4-5-9-19(18)26/h3-10,26H,11-16H2,1-2H3,(H,22,23) |
| InChIKey | ALBNDXBZHURIPQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|