About 2-[3-[(2Z,6Z)-cycloocta-2,6-dien-1-yl]propoxy]oxane
2-[3-[(2Z,6Z)-cycloocta-2,6-dien-1-yl]propoxy]oxane (PubChem CID 11118498) has the molecular formula C16H26O2
and a molecular weight of 250.38 g/mol. Its IUPAC name is 2-[3-[(2Z,6Z)-cycloocta-2,6-dien-1-yl]propoxy]oxane.
Molecular Properties
| Compound Name | 2-[3-[(2Z,6Z)-cycloocta-2,6-dien-1-yl]propoxy]oxane |
| PubChem CID | 11118498 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 2-[3-[(2Z,6Z)-cycloocta-2,6-dien-1-yl]propoxy]oxane |
| SMILES | C1=C\CC(CCCOC2CCCCO2)/C=C\CC/1 |
| InChI | InChI=1S/C16H26O2/c1-2-4-9-15(10-5-3-1)11-8-14-18-16-12-6-7-13-17-16/h2,4-5,10,15-16H,1,3,6-9,11-14H2/b4-2-,10-5- |
| InChIKey | DTSOOORYWCIASP-DYYLMRJSSA-N |
| XLogP | 4.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-[(2Z,6Z)-cycloocta-2,6-dien-1-yl]propoxy]oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[(2Z,6Z)-cycloocta-2,6-dien-1-yl]propoxy]oxane?
The IUPAC name of 2-[3-[(2Z,6Z)-cycloocta-2,6-dien-1-yl]propoxy]oxane (CID 11118498) is 2-[3-[(2Z,6Z)-cycloocta-2,6-dien-1-yl]propoxy]oxane.
What is the SMILES notation for 2-[3-[(2Z,6Z)-cycloocta-2,6-dien-1-yl]propoxy]oxane?
The canonical SMILES for 2-[3-[(2Z,6Z)-cycloocta-2,6-dien-1-yl]propoxy]oxane is C1=C\CC(CCCOC2CCCCO2)/C=C\CC/1.
What is the InChIKey of 2-[3-[(2Z,6Z)-cycloocta-2,6-dien-1-yl]propoxy]oxane?
The InChIKey is DTSOOORYWCIASP-DYYLMRJSSA-N. The full InChI is InChI=1S/C16H26O2/c1-2-4-9-15(10-5-3-1)11-8-14-18-16-12-6-7-13-17-16/h2,4-5,10,15-16H,1,3,6-9,11-14H2/b4-2-,10-5-.
What are the key properties of 2-[3-[(2Z,6Z)-cycloocta-2,6-dien-1-yl]propoxy]oxane?
2-[3-[(2Z,6Z)-cycloocta-2,6-dien-1-yl]propoxy]oxane has a molecular weight of 250.38 g/mol, XLogP of 4.22, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[(2Z,6Z)-cycloocta-2,6-dien-1-yl]propoxy]oxane is sourced from PubChem (CID 11118498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).