About [(R)-[(4S)-6,6-dimethylhept-1-en-4-yl]sulfinyl]benzene
[(R)-[(4S)-6,6-dimethylhept-1-en-4-yl]sulfinyl]benzene (PubChem CID 11118501) has the molecular formula C15H22OS
and a molecular weight of 250.41 g/mol. Its IUPAC name is [(R)-[(4S)-6,6-dimethylhept-1-en-4-yl]sulfinyl]benzene.
Molecular Properties
| Compound Name | [(R)-[(4S)-6,6-dimethylhept-1-en-4-yl]sulfinyl]benzene |
| PubChem CID | 11118501 |
| Molecular Formula | C15H22OS |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | [(R)-[(4S)-6,6-dimethylhept-1-en-4-yl]sulfinyl]benzene |
| SMILES | C=CC[C@@H](CC(C)(C)C)[S@@](=O)c1ccccc1 |
| InChI | InChI=1S/C15H22OS/c1-5-9-14(12-15(2,3)4)17(16)13-10-7-6-8-11-13/h5-8,10-11,14H,1,9,12H2,2-4H3/t14-,17-/m0/s1 |
| InChIKey | NRKVHRSWBSJLJP-YOEHRIQHSA-N |
| XLogP | 4.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(R)-[(4S)-6,6-dimethylhept-1-en-4-yl]sulfinyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(R)-[(4S)-6,6-dimethylhept-1-en-4-yl]sulfinyl]benzene?
The IUPAC name of [(R)-[(4S)-6,6-dimethylhept-1-en-4-yl]sulfinyl]benzene (CID 11118501) is [(R)-[(4S)-6,6-dimethylhept-1-en-4-yl]sulfinyl]benzene.
What is the SMILES notation for [(R)-[(4S)-6,6-dimethylhept-1-en-4-yl]sulfinyl]benzene?
The canonical SMILES for [(R)-[(4S)-6,6-dimethylhept-1-en-4-yl]sulfinyl]benzene is C=CC[C@@H](CC(C)(C)C)[S@@](=O)c1ccccc1.
What is the InChIKey of [(R)-[(4S)-6,6-dimethylhept-1-en-4-yl]sulfinyl]benzene?
The InChIKey is NRKVHRSWBSJLJP-YOEHRIQHSA-N. The full InChI is InChI=1S/C15H22OS/c1-5-9-14(12-15(2,3)4)17(16)13-10-7-6-8-11-13/h5-8,10-11,14H,1,9,12H2,2-4H3/t14-,17-/m0/s1.
What are the key properties of [(R)-[(4S)-6,6-dimethylhept-1-en-4-yl]sulfinyl]benzene?
[(R)-[(4S)-6,6-dimethylhept-1-en-4-yl]sulfinyl]benzene has a molecular weight of 250.41 g/mol, XLogP of 4.18, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(R)-[(4S)-6,6-dimethylhept-1-en-4-yl]sulfinyl]benzene is sourced from PubChem (CID 11118501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).