C24H31ClIN5O — CID 111186992
4-(3-chlorophenyl)-N'-methyl-N-[[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111186992) has the molecular formula C24H31ClIN5O and a molecular weight of 567.90 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-N'-methyl-N-[[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(3-chlorophenyl)-N'-methyl-N-[[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111186992 |
| Molecular Formula | C24H31ClIN5O |
| Molecular Weight | 567.90 g/mol |
| Exact Mass | 567.13 |
| IUPAC Name | 4-(3-chlorophenyl)-N'-methyl-N-[[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(CN2CCCC2=O)cc1)N1CCN(c2cccc(Cl)c2)CC1.I |
| InChI | InChI=1S/C24H30ClN5O.HI/c1-26-24(29-14-12-28(13-15-29)22-5-2-4-21(25)16-22)27-17-19-7-9-20(10-8-19)18-30-11-3-6-23(30)31;/h2,4-5,7-10,16H,3,6,11-15,17-18H2,1H3,(H,26,27);1H |
| InChIKey | AMIGKNMJHDQGJI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.90 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|