C18H33N7O2 — CID 111187819
1-ethyl-3-(2-morpholin-4-ylethyl)-2-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine (PubChem CID 111187819) has the molecular formula C18H33N7O2 and a molecular weight of 379.51 g/mol. Its IUPAC name is 1-ethyl-3-(2-morpholin-4-ylethyl)-2-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine.
| Compound Name | 1-ethyl-3-(2-morpholin-4-ylethyl)-2-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111187819 |
| Molecular Formula | C18H33N7O2 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.27 |
| IUPAC Name | 1-ethyl-3-(2-morpholin-4-ylethyl)-2-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine |
| SMILES | CCN/C(=N\CCCn1nc2n(c1=O)CCCC2)NCCN1CCOCC1 |
| InChI | InChI=1S/C18H33N7O2/c1-2-19-17(21-8-11-23-12-14-27-15-13-23)20-7-5-10-25-18(26)24-9-4-3-6-16(24)22-25/h2-15H2,1H3,(H2,19,20,21) |
| InChIKey | JUJBEEPCBSFASU-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|