C12H20O4S — CID 11118809
(3S,6R,7R)-6-methyl-1,1-dioxo-3-propyl-3,4,5,6,7,8-hexahydro-2,1λ6-benzoxathiin-7-ol (PubChem CID 11118809) has the molecular formula C12H20O4S and a molecular weight of 260.35 g/mol. Its IUPAC name is (3S,6R,7R)-6-methyl-1,1-dioxo-3-propyl-3,4,5,6,7,8-hexahydro-2,1λ6-benzoxathiin-7-ol.
| Compound Name | (3S,6R,7R)-6-methyl-1,1-dioxo-3-propyl-3,4,5,6,7,8-hexahydro-2,1λ6-benzoxathiin-7-ol |
|---|---|
| PubChem CID | 11118809 |
| Molecular Formula | C12H20O4S |
| Molecular Weight | 260.35 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | (3S,6R,7R)-6-methyl-1,1-dioxo-3-propyl-3,4,5,6,7,8-hexahydro-2,1λ6-benzoxathiin-7-ol |
| SMILES | CCC[C@H]1CC2=C(C[C@@H](O)[C@H](C)C2)S(=O)(=O)O1 |
| InChI | InChI=1S/C12H20O4S/c1-3-4-10-6-9-5-8(2)11(13)7-12(9)17(14,15)16-10/h8,10-11,13H,3-7H2,1-2H3/t8-,10+,11-/m1/s1 |
| InChIKey | OHHARLVTSVFSDJ-DVVUODLYSA-N |
| XLogP | 1.95 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|