C17H36IN5O — CID 111188128
1-ethyl-3-[2-(3-methylpiperidin-1-yl)ethyl]-2-(2-morpholin-4-ylethyl)guanidine;hydroiodide (PubChem CID 111188128) has the molecular formula C17H36IN5O and a molecular weight of 453.41 g/mol. Its IUPAC name is 1-ethyl-3-[2-(3-methylpiperidin-1-yl)ethyl]-2-(2-morpholin-4-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(3-methylpiperidin-1-yl)ethyl]-2-(2-morpholin-4-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111188128 |
| Molecular Formula | C17H36IN5O |
| Molecular Weight | 453.41 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | 1-ethyl-3-[2-(3-methylpiperidin-1-yl)ethyl]-2-(2-morpholin-4-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCN1CCOCC1)NCCN1CCCC(C)C1.I |
| InChI | InChI=1S/C17H35N5O.HI/c1-3-18-17(19-6-9-21-11-13-23-14-12-21)20-7-10-22-8-4-5-16(2)15-22;/h16H,3-15H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | ZPWCDZZMTPNMTB-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.41 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|