C24H40N6O2 — CID 111188849
4-(1,3-benzodioxol-5-ylmethyl)-N-ethyl-N'-[2-(4-ethylpiperazin-1-yl)propyl]piperazine-1-carboximidamide (PubChem CID 111188849) has the molecular formula C24H40N6O2 and a molecular weight of 444.62 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-ylmethyl)-N-ethyl-N'-[2-(4-ethylpiperazin-1-yl)propyl]piperazine-1-carboximidamide.
| Compound Name | 4-(1,3-benzodioxol-5-ylmethyl)-N-ethyl-N'-[2-(4-ethylpiperazin-1-yl)propyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111188849 |
| Molecular Formula | C24H40N6O2 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.32 |
| IUPAC Name | 4-(1,3-benzodioxol-5-ylmethyl)-N-ethyl-N'-[2-(4-ethylpiperazin-1-yl)propyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(C)N1CCN(CC)CC1)N1CCN(Cc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C24H40N6O2/c1-4-25-24(26-17-20(3)29-12-8-27(5-2)9-13-29)30-14-10-28(11-15-30)18-21-6-7-22-23(16-21)32-19-31-22/h6-7,16,20H,4-5,8-15,17-19H2,1-3H3,(H,25,26) |
| InChIKey | YQKDEXHPWWFLLM-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|