C14H26F3N3O2 — CID 111189968
1-ethyl-3-(4-hydroxycyclohexyl)-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine (PubChem CID 111189968) has the molecular formula C14H26F3N3O2 and a molecular weight of 325.38 g/mol. Its IUPAC name is 1-ethyl-3-(4-hydroxycyclohexyl)-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine.
| Compound Name | 1-ethyl-3-(4-hydroxycyclohexyl)-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111189968 |
| Molecular Formula | C14H26F3N3O2 |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 1-ethyl-3-(4-hydroxycyclohexyl)-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine |
| SMILES | CCN/C(=N\CCCOCC(F)(F)F)NC1CCC(O)CC1 |
| InChI | InChI=1S/C14H26F3N3O2/c1-2-18-13(20-11-4-6-12(21)7-5-11)19-8-3-9-22-10-14(15,16)17/h11-12,21H,2-10H2,1H3,(H2,18,19,20) |
| InChIKey | UXVFGFOVYSRKKZ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|