C15H22O4 — CID 11119010
tert-butyl (1R,5S,7R)-8-oxo-11-oxatricyclo[5.3.1.01,5]undecane-7-carboxylate (PubChem CID 11119010) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is tert-butyl (1R,5S,7R)-8-oxo-11-oxatricyclo[5.3.1.01,5]undecane-7-carboxylate.
| Compound Name | tert-butyl (1R,5S,7R)-8-oxo-11-oxatricyclo[5.3.1.01,5]undecane-7-carboxylate |
|---|---|
| PubChem CID | 11119010 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | tert-butyl (1R,5S,7R)-8-oxo-11-oxatricyclo[5.3.1.01,5]undecane-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@]12C[C@@H]3CCC[C@]3(CCC1=O)O2 |
| InChI | InChI=1S/C15H22O4/c1-13(2,3)18-12(17)15-9-10-5-4-7-14(10,19-15)8-6-11(15)16/h10H,4-9H2,1-3H3/t10-,14+,15+/m0/s1 |
| InChIKey | FNVBBKJSAGPGHN-COLVAYQJSA-N |
| XLogP | 2.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|