C13H7Br2NO2S — CID 1111914
6,8-dibromo-3-(2-methyl-1,3-thiazol-4-yl)chromen-2-one (PubChem CID 1111914) has the molecular formula C13H7Br2NO2S and a molecular weight of 401.08 g/mol. Its IUPAC name is 6,8-dibromo-3-(2-methyl-1,3-thiazol-4-yl)chromen-2-one.
| Compound Name | 6,8-dibromo-3-(2-methyl-1,3-thiazol-4-yl)chromen-2-one |
|---|---|
| PubChem CID | 1111914 |
| Molecular Formula | C13H7Br2NO2S |
| Molecular Weight | 401.08 g/mol |
| Exact Mass | 398.86 |
| IUPAC Name | 6,8-dibromo-3-(2-methyl-1,3-thiazol-4-yl)chromen-2-one |
| SMILES | Cc1nc(-c2cc3cc(Br)cc(Br)c3oc2=O)cs1 |
| InChI | InChI=1S/C13H7Br2NO2S/c1-6-16-11(5-19-6)9-3-7-2-8(14)4-10(15)12(7)18-13(9)17/h2-5H,1H3 |
| InChIKey | KMSJUYVFHALBTB-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.08 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|